C22H25F3N2O5 — CID 127024017
[(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127024017) has the molecular formula C22H25F3N2O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is [(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024017 |
| Molecular Formula | C22H25F3N2O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1occc1C(=O)N1C[C@H]2CCCC(OCc3cccnc3)[C@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H24N2O3.C2HF3O2/c1-14-17(7-9-24-14)20(23)22-11-16-5-2-6-19(18(16)12-22)25-13-15-4-3-8-21-10-15;3-2(4,5)1(6)7/h3-4,7-10,16,18-19H,2,5-6,11-13H2,1H3;(H,6,7)/t16-,18+,19?;/m1./s1 |
| InChIKey | IDMXQQGEKPAKBH-UCVFPQCCSA-N |
| XLogP | 4.07 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |