C16H24N2O3S — CID 133139934
(3aS,7aR)-2-ethylsulfonyl-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 133139934) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is (3aS,7aR)-2-ethylsulfonyl-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,7aR)-2-ethylsulfonyl-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 133139934 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3aS,7aR)-2-ethylsulfonyl-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CCS(=O)(=O)N1C[C@@H]2CCCC(OCc3cccnc3)[C@@H]2C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-2-22(19,20)18-10-14-6-3-7-16(15(14)11-18)21-12-13-5-4-8-17-9-13/h4-5,8-9,14-16H,2-3,6-7,10-12H2,1H3/t14-,15+,16?/m0/s1 |
| InChIKey | POISFDVXUKMJSI-QMRHZFGWSA-N |
| XLogP | 2.05 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |