C16H25N3O3S — CID 91915792
(5aS,9aS)-8-ethylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine (PubChem CID 91915792) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is (5aS,9aS)-8-ethylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine.
| Compound Name | (5aS,9aS)-8-ethylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine |
|---|---|
| PubChem CID | 91915792 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (5aS,9aS)-8-ethylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine |
| SMILES | CCS(=O)(=O)N1CC[C@@H]2COCCN(Cc3cccnc3)[C@@H]2C1 |
| InChI | InChI=1S/C16H25N3O3S/c1-2-23(20,21)19-7-5-15-13-22-9-8-18(16(15)12-19)11-14-4-3-6-17-10-14/h3-4,6,10,15-16H,2,5,7-9,11-13H2,1H3/t15-,16-/m1/s1 |
| InChIKey | NPMPIVHRNRODSJ-HZPDHXFCSA-N |
| XLogP | 0.95 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |