C19H25F6N3O7S — CID 155852650
(4aS,8aS)-6-ethylsulfonyl-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155852650) has the molecular formula C19H25F6N3O7S and a molecular weight of 553.48 g/mol. Its IUPAC name is (4aS,8aS)-6-ethylsulfonyl-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,8aS)-6-ethylsulfonyl-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155852650 |
| Molecular Formula | C19H25F6N3O7S |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | (4aS,8aS)-6-ethylsulfonyl-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCS(=O)(=O)N1CC[C@@H]2OCCN(Cc3ccncc3)[C@H]2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O3S.2C2HF3O2/c1-2-22(19,20)18-8-5-15-14(12-18)17(9-10-21-15)11-13-3-6-16-7-4-13;2*3-2(4,5)1(6)7/h3-4,6-7,14-15H,2,5,8-12H2,1H3;2*(H,6,7)/t14-,15-;;/m0../s1 |
| InChIKey | RMDGEEVFDHDWCK-WVFPUEBHSA-N |
| XLogP | 1.97 |
| TPSA | 137.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |