C21H31N3O2 — CID 131685934
[(4aS,8aS)-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylcyclohexyl)methanone (PubChem CID 131685934) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is [(4aS,8aS)-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylcyclohexyl)methanone.
| Compound Name | [(4aS,8aS)-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 131685934 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | [(4aS,8aS)-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)N2CC[C@@H]3OCCN(Cc4ccncc4)[C@H]3C2)CC1 |
| InChI | InChI=1S/C21H31N3O2/c1-16-2-4-18(5-3-16)21(25)24-11-8-20-19(15-24)23(12-13-26-20)14-17-6-9-22-10-7-17/h6-7,9-10,16,18-20H,2-5,8,11-15H2,1H3/t16?,18?,19-,20-/m0/s1 |
| InChIKey | JYAMZOCBTUYQRL-QUDVFMAMSA-N |
| XLogP | 2.71 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |