C18H25N5O — CID 125191808
(4aR,8aS)-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 125191808) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is (4aR,8aS)-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | (4aR,8aS)-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 125191808 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (4aR,8aS)-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | Cc1ncc(CN2CC[C@@H]3OCCN(Cc4ccncc4)[C@@H]3C2)[nH]1 |
| InChI | InChI=1S/C18H25N5O/c1-14-20-10-16(21-14)12-22-7-4-18-17(13-22)23(8-9-24-18)11-15-2-5-19-6-3-15/h2-3,5-6,10,17-18H,4,7-9,11-13H2,1H3,(H,20,21)/t17-,18+/m1/s1 |
| InChIKey | ZLYZKYQNARLUFD-MSOLQXFVSA-N |
| XLogP | 1.59 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |