C15H18N4OS — CID 124791652
(4aS,7aR)-4-(pyridin-4-ylmethyl)-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 124791652) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is (4aS,7aR)-4-(pyridin-4-ylmethyl)-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aR)-4-(pyridin-4-ylmethyl)-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 124791652 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (4aS,7aR)-4-(pyridin-4-ylmethyl)-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | c1cc(CN2CCO[C@@H]3CN(c4nccs4)C[C@@H]32)ccn1 |
| InChI | InChI=1S/C15H18N4OS/c1-3-16-4-2-12(1)9-18-6-7-20-14-11-19(10-13(14)18)15-17-5-8-21-15/h1-5,8,13-14H,6-7,9-11H2/t13-,14+/m0/s1 |
| InChIKey | SYCWAEKSLDGBIT-UONOGXRCSA-N |
| XLogP | 1.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |