C19H26N4OS — CID 133494608
4-benzyl-6-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 133494608) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 4-benzyl-6-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | 4-benzyl-6-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 133494608 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-benzyl-6-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CC(C)(C)c1nsc(N2CC3OCCN(Cc4ccccc4)C3C2)n1 |
| InChI | InChI=1S/C19H26N4OS/c1-19(2,3)17-20-18(25-21-17)23-12-15-16(13-23)24-10-9-22(15)11-14-7-5-4-6-8-14/h4-8,15-16H,9-13H2,1-3H3 |
| InChIKey | WISCCTVEOYVTKB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |