C20H23N5O — CID 124729730
3-[(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 124729730) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-[(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-5,6-dimethylpyridazine-4-carbonitrile.
| Compound Name | 3-[(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-5,6-dimethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 124729730 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-[(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | Cc1nnc(N2C[C@@H]3OCCN(Cc4ccccc4)[C@H]3C2)c(C#N)c1C |
| InChI | InChI=1S/C20H23N5O/c1-14-15(2)22-23-20(17(14)10-21)25-12-18-19(13-25)26-9-8-24(18)11-16-6-4-3-5-7-16/h3-7,18-19H,8-9,11-13H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | GPWGAYQTTLADPI-OALUTQOASA-N |
| XLogP | 2.05 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |