C18H19N5O — CID 133420208
6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridazine-3-carbonitrile (PubChem CID 133420208) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridazine-3-carbonitrile.
| Compound Name | 6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133420208 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CC3OCCN(Cc4ccccc4)C3C2)nn1 |
| InChI | InChI=1S/C18H19N5O/c19-10-15-6-7-18(21-20-15)23-12-16-17(13-23)24-9-8-22(16)11-14-4-2-1-3-5-14/h1-7,16-17H,8-9,11-13H2 |
| InChIKey | BJUOLMCQILJUDH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |