C21H26FN3O — CID 124789463
(4aR,8aR)-6-[(4-fluoro-2-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 124789463) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is (4aR,8aR)-6-[(4-fluoro-2-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | (4aR,8aR)-6-[(4-fluoro-2-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 124789463 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4aR,8aR)-6-[(4-fluoro-2-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | Cc1cc(F)ccc1CN1CC[C@H]2OCCN(Cc3ccncc3)[C@@H]2C1 |
| InChI | InChI=1S/C21H26FN3O/c1-16-12-19(22)3-2-18(16)14-24-9-6-21-20(15-24)25(10-11-26-21)13-17-4-7-23-8-5-17/h2-5,7-8,12,20-21H,6,9-11,13-15H2,1H3/t20-,21-/m1/s1 |
| InChIKey | HTQAZSAJFGTCKT-NHCUHLMSSA-N |
| XLogP | 3.00 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |