C18H23N5O2 — CID 124813592
[(4aR,8aR)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-2-yl)methanone (PubChem CID 124813592) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(4aR,8aR)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [(4aR,8aR)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 124813592 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [(4aR,8aR)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-2-yl)methanone |
| SMILES | Cn1ccnc1C(=O)N1CC[C@H]2OCCN(Cc3cccnc3)[C@@H]2C1 |
| InChI | InChI=1S/C18H23N5O2/c1-21-8-6-20-17(21)18(24)23-7-4-16-15(13-23)22(9-10-25-16)12-14-3-2-5-19-11-14/h2-3,5-6,8,11,15-16H,4,7,9-10,12-13H2,1H3/t15-,16-/m1/s1 |
| InChIKey | ANJRHSHFHHDIDP-HZPDHXFCSA-N |
| XLogP | 0.93 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |