C20H24N4O3 — CID 131688168
1-[2-[(4aS,8aS)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-oxoethyl]pyridin-2-one (PubChem CID 131688168) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[2-[(4aS,8aS)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-oxoethyl]pyridin-2-one.
| Compound Name | 1-[2-[(4aS,8aS)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 131688168 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[2-[(4aS,8aS)-4-(pyridin-3-ylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-oxoethyl]pyridin-2-one |
| SMILES | O=C(Cn1ccccc1=O)N1CC[C@@H]2OCCN(Cc3cccnc3)[C@H]2C1 |
| InChI | InChI=1S/C20H24N4O3/c25-19-5-1-2-8-23(19)15-20(26)24-9-6-18-17(14-24)22(10-11-27-18)13-16-4-3-7-21-12-16/h1-5,7-8,12,17-18H,6,9-11,13-15H2/t17-,18-/m0/s1 |
| InChIKey | DCXUFXAQIPBMFP-ROUUACIJSA-N |
| XLogP | 0.75 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |