C17H23N3O2 — CID 131656647
[(3aS,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(oxolan-3-yl)methanone (PubChem CID 131656647) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is [(3aS,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(oxolan-3-yl)methanone.
| Compound Name | [(3aS,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 131656647 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | [(3aS,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(oxolan-3-yl)methanone |
| SMILES | O=C(C1CCOC1)N1C[C@@H]2CCN(Cc3cccnc3)[C@@H]2C1 |
| InChI | InChI=1S/C17H23N3O2/c21-17(15-4-7-22-12-15)20-10-14-3-6-19(16(14)11-20)9-13-2-1-5-18-8-13/h1-2,5,8,14-16H,3-4,6-7,9-12H2/t14-,15?,16+/m0/s1 |
| InChIKey | VNTUUDPUTIKJOG-DLDKDUQYSA-N |
| XLogP | 1.15 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |