C17H19N5O — CID 124792589
[(3aS,6aR)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyridazin-4-ylmethanone (PubChem CID 124792589) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is [(3aS,6aR)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(3aS,6aR)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 124792589 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [(3aS,6aR)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1CC[C@@H]2[C@@H]1CCN2Cc1cccnc1 |
| InChI | InChI=1S/C17H19N5O/c23-17(14-3-7-19-20-11-14)22-9-5-15-16(22)4-8-21(15)12-13-2-1-6-18-10-13/h1-3,6-7,10-11,15-16H,4-5,8-9,12H2/t15-,16+/m1/s1 |
| InChIKey | KEFCKXFKRLKXRP-CVEARBPZSA-N |
| XLogP | 1.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |