C22H21F7N4O5 — CID 155865153
[(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2-fluoro-4-pyridinyl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155865153) has the molecular formula C22H21F7N4O5 and a molecular weight of 554.42 g/mol. Its IUPAC name is [(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2-fluoro-4-pyridinyl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2-fluoro-4-pyridinyl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155865153 |
| Molecular Formula | C22H21F7N4O5 |
| Molecular Weight | 554.42 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | [(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2-fluoro-4-pyridinyl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(c1ccnc(F)c1)N1CC[C@H]2[C@H]1CCN2Cc1cccnc1 |
| InChI | InChI=1S/C18H19FN4O.2C2HF3O2/c19-17-10-14(3-7-21-17)18(24)23-9-5-15-16(23)4-8-22(15)12-13-2-1-6-20-11-13;2*3-2(4,5)1(6)7/h1-3,6-7,10-11,15-16H,4-5,8-9,12H2;2*(H,6,7)/t15-,16+;;/m0../s1 |
| InChIKey | XGGTWFLBOFNACJ-SLAHTUFOSA-N |
| XLogP | 3.37 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|