C19H20F3N3O4 — CID 171693486
[(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 171693486) has the molecular formula C19H20F3N3O4 and a molecular weight of 411.38 g/mol. Its IUPAC name is [(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171693486 |
| Molecular Formula | C19H20F3N3O4 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [(3aR,6aS)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccoc1)N1CC[C@H]2[C@H]1CCN2Cc1cccnc1 |
| InChI | InChI=1S/C17H19N3O2.C2HF3O2/c21-17(14-5-9-22-12-14)20-8-4-15-16(20)3-7-19(15)11-13-2-1-6-18-10-13;3-2(4,5)1(6)7/h1-2,5-6,9-10,12,15-16H,3-4,7-8,11H2;(H,6,7)/t15-,16+;/m0./s1 |
| InChIKey | RPMPQNGFKGDFMG-IDVLALEDSA-N |
| XLogP | 2.80 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |