C17H21F6N3O6S — CID 171672483
(3aS,6aR)-4-methylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171672483) has the molecular formula C17H21F6N3O6S and a molecular weight of 509.43 g/mol. Its IUPAC name is (3aS,6aR)-4-methylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,6aR)-4-methylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171672483 |
| Molecular Formula | C17H21F6N3O6S |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | (3aS,6aR)-4-methylsulfonyl-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CS(=O)(=O)N1CC[C@@H]2[C@@H]1CCN2Cc1cccnc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N3O2S.2C2HF3O2/c1-19(17,18)16-8-5-12-13(16)4-7-15(12)10-11-3-2-6-14-9-11;2*3-2(4,5)1(6)7/h2-3,6,9,12-13H,4-5,7-8,10H2,1H3;2*(H,6,7)/t12-,13+;;/m1../s1 |
| InChIKey | KVMIVFGGIRGRIA-VAALMUBNSA-N |
| XLogP | 1.96 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |