C20H22F4N4O3 — CID 155828577
[(3aS,6aR)-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1-methylpyrazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155828577) has the molecular formula C20H22F4N4O3 and a molecular weight of 442.41 g/mol. Its IUPAC name is [(3aS,6aR)-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1-methylpyrazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aS,6aR)-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1-methylpyrazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828577 |
| Molecular Formula | C20H22F4N4O3 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [(3aS,6aR)-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1-methylpyrazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(C(=O)N2CC[C@@H]3[C@@H]2CCN3Cc2ccc(F)cc2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21FN4O.C2HF3O2/c1-21-12-14(10-20-21)18(24)23-9-7-16-17(23)6-8-22(16)11-13-2-4-15(19)5-3-13;3-2(4,5)1(6)7/h2-5,10,12,16-17H,6-9,11H2,1H3;(H,6,7)/t16-,17+;/m1./s1 |
| InChIKey | CXCRQJFMWUUHAE-PPPUBMIESA-N |
| XLogP | 2.68 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |