C23H25F6N5O4 — CID 155823582
3-[[(3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155823582) has the molecular formula C23H25F6N5O4 and a molecular weight of 549.47 g/mol. Its IUPAC name is 3-[[(3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[[(3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155823582 |
| Molecular Formula | C23H25F6N5O4 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 3-[[(3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CC[C@@H]3[C@@H]2CCN3Cc2cccc(C#N)c2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N5.2C2HF3O2/c1-22-12-17(11-21-22)14-24-8-6-18-19(24)5-7-23(18)13-16-4-2-3-15(9-16)10-20;2*3-2(4,5)1(6)7/h2-4,9,11-12,18-19H,5-8,13-14H2,1H3;2*(H,6,7)/t18-,19+;;/m1../s1 |
| InChIKey | UUMFGJQPNOHFNW-QNCHGCKQSA-N |
| XLogP | 3.41 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |