C19H22F3N3O4 — CID 155825991
(2R,3aS,6aS)-4-[(3-cyanophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155825991) has the molecular formula C19H22F3N3O4 and a molecular weight of 413.40 g/mol. Its IUPAC name is (2R,3aS,6aS)-4-[(3-cyanophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,6aS)-4-[(3-cyanophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825991 |
| Molecular Formula | C19H22F3N3O4 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2R,3aS,6aS)-4-[(3-cyanophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)[C@H]1C[C@H]2[C@H](CCN2Cc2cccc(C#N)c2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21N3O2.C2HF3O2/c1-19(2)17(21)16-9-14-15(22-16)6-7-20(14)11-13-5-3-4-12(8-13)10-18;3-2(4,5)1(6)7/h3-5,8,14-16H,6-7,9,11H2,1-2H3;(H,6,7)/t14-,15-,16+;/m0./s1 |
| InChIKey | SDXZYFULFKSPGY-MLZPLGHASA-N |
| XLogP | 2.01 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |