C21H27F6N3O7 — CID 171685843
[(2R,3aS,6aS)-4-(furan-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171685843) has the molecular formula C21H27F6N3O7 and a molecular weight of 547.45 g/mol. Its IUPAC name is [(2R,3aS,6aS)-4-(furan-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(2R,3aS,6aS)-4-(furan-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171685843 |
| Molecular Formula | C21H27F6N3O7 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [(2R,3aS,6aS)-4-(furan-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCN(C(=O)[C@H]2C[C@H]3[C@H](CCN3Cc3ccco3)O2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3.2C2HF3O2/c1-18-6-8-19(9-7-18)17(21)16-11-14-15(23-16)4-5-20(14)12-13-3-2-10-22-13;2*3-2(4,5)1(6)7/h2-3,10,14-16H,4-9,11-12H2,1H3;2*(H,6,7)/t14-,15-,16+;;/m0../s1 |
| InChIKey | XRHLRLCQLDUUHR-WKXLSLHPSA-N |
| XLogP | 2.05 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |