C17H23F3N2O5 — CID 155853066
(3aR,5R,7aR)-1-(furan-2-ylmethyl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155853066) has the molecular formula C17H23F3N2O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-(furan-2-ylmethyl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-1-(furan-2-ylmethyl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853066 |
| Molecular Formula | C17H23F3N2O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (3aR,5R,7aR)-1-(furan-2-ylmethyl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H]2[C@@H](CCN2Cc2ccco2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O3.C2HF3O2/c1-16(2)15(18)14-6-5-12-13(20-14)7-8-17(12)10-11-4-3-9-19-11;3-2(4,5)1(6)7/h3-4,9,12-14H,5-8,10H2,1-2H3;(H,6,7)/t12-,13-,14-;/m1./s1 |
| InChIKey | HPEUFKJIECPBIO-MBLYYGPHSA-N |
| XLogP | 2.12 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |