C17H23F3N4O4 — CID 155859375
(3aR,5R,7aR)-N,N-dimethyl-1-(6-methylpyridazin-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155859375) has the molecular formula C17H23F3N4O4 and a molecular weight of 404.39 g/mol. Its IUPAC name is (3aR,5R,7aR)-N,N-dimethyl-1-(6-methylpyridazin-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N,N-dimethyl-1-(6-methylpyridazin-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155859375 |
| Molecular Formula | C17H23F3N4O4 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (3aR,5R,7aR)-N,N-dimethyl-1-(6-methylpyridazin-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(N2CC[C@H]3O[C@@H](C(=O)N(C)C)CC[C@H]32)nn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O2.C2HF3O2/c1-10-4-7-14(17-16-10)19-9-8-12-11(19)5-6-13(21-12)15(20)18(2)3;3-2(4,5)1(6)7/h4,7,11-13H,5-6,8-9H2,1-3H3;(H,6,7)/t11-,12-,13-;/m1./s1 |
| InChIKey | JUTMWHKFDQYICX-NLPVPVDASA-N |
| XLogP | 1.63 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |