C17H22F3N3O5 — CID 155869640
(3aR,5S,7aR)-N,N-dimethyl-1-(1H-pyrrole-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155869640) has the molecular formula C17H22F3N3O5 and a molecular weight of 405.37 g/mol. Its IUPAC name is (3aR,5S,7aR)-N,N-dimethyl-1-(1H-pyrrole-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5S,7aR)-N,N-dimethyl-1-(1H-pyrrole-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869640 |
| Molecular Formula | C17H22F3N3O5 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (3aR,5S,7aR)-N,N-dimethyl-1-(1H-pyrrole-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)[C@@H]1CC[C@@H]2[C@@H](CCN2C(=O)c2cc[nH]c2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21N3O3.C2HF3O2/c1-17(2)15(20)13-4-3-11-12(21-13)6-8-18(11)14(19)10-5-7-16-9-10;3-2(4,5)1(6)7/h5,7,9,11-13,16H,3-4,6,8H2,1-2H3;(H,6,7)/t11-,12-,13+;/m1./s1 |
| InChIKey | WFGXJOJMAIJNFQ-GMSSCWEGSA-N |
| XLogP | 1.50 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |