C20H25F6N3O6 — CID 127023553
(3aR,5R,7aR)-N,N-dimethyl-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023553) has the molecular formula C20H25F6N3O6 and a molecular weight of 517.42 g/mol. Its IUPAC name is (3aR,5R,7aR)-N,N-dimethyl-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,5R,7aR)-N,N-dimethyl-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023553 |
| Molecular Formula | C20H25F6N3O6 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (3aR,5R,7aR)-N,N-dimethyl-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H]2[C@@H](CCN2Cc2ccccn2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N3O2.2C2HF3O2/c1-18(2)16(20)15-7-6-13-14(21-15)8-10-19(13)11-12-5-3-4-9-17-12;2*3-2(4,5)1(6)7/h3-5,9,13-15H,6-8,10-11H2,1-2H3;2*(H,6,7)/t13-,14-,15-;;/m1../s1 |
| InChIKey | LTXZIZMZCHQMLJ-CRCLDWEMSA-N |
| XLogP | 2.56 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |