C15H20F3N3O4S — CID 127022761
(2S,3aR,6aR)-N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022761) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is (2S,3aR,6aR)-N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aR,6aR)-N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022761 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (2S,3aR,6aR)-N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)[C@@H]1C[C@@H]2[C@@H](CCN2Cc2nccs2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N3O2S.C2HF3O2/c1-15(2)13(17)11-7-9-10(18-11)3-5-16(9)8-12-14-4-6-19-12;3-2(4,5)1(6)7/h4,6,9-11H,3,5,7-8H2,1-2H3;(H,6,7)/t9-,10-,11+;/m1./s1 |
| InChIKey | UORZAWAAEPYVGT-NQHCQCOHSA-N |
| XLogP | 1.60 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |