C20H25F9N4O7S — CID 155840586
2-[(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;tris(2,2,2-trifluoroacetic acid) (PubChem CID 155840586) has the molecular formula C20H25F9N4O7S and a molecular weight of 636.49 g/mol. Its IUPAC name is 2-[(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;tris(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155840586 |
| Molecular Formula | C20H25F9N4O7S |
| Molecular Weight | 636.49 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 2-[(3aS,6aR)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;tris(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C(=O)CN1CC[C@@H]2[C@@H]1CCN2Cc1nccs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4OS.3C2HF3O2/c1-16(2)14(19)10-18-7-4-11-12(18)3-6-17(11)9-13-15-5-8-20-13;3*3-2(4,5)1(6)7/h5,8,11-12H,3-4,6-7,9-10H2,1-2H3;3*(H,6,7)/t11-,12+;;;/m1.../s1 |
| InChIKey | ZAXKDUGQRULEFM-GDGSLZPISA-N |
| XLogP | 2.78 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |