C11H17N3O2S2 — CID 97459042
2-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole (PubChem CID 97459042) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97459042 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole |
| SMILES | CS(=O)(=O)N1CC[C@@H]2[C@@H]1CCN2Cc1nccs1 |
| InChI | InChI=1S/C11H17N3O2S2/c1-18(15,16)14-6-3-9-10(14)2-5-13(9)8-11-12-4-7-17-11/h4,7,9-10H,2-3,5-6,8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | HDEITFRZELNCKZ-ZJUUUORDSA-N |
| XLogP | 0.75 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |