C16H25N3OS — CID 97420776
2-[[(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-1,3-thiazole (PubChem CID 97420776) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-[[(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97420776 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-[[(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]methyl]-1,3-thiazole |
| SMILES | CO[C@@H]1CCN(Cc2nccs2)[C@@H]2CN(CC3CC3)C[C@@H]21 |
| InChI | InChI=1S/C16H25N3OS/c1-20-15-4-6-19(11-16-17-5-7-21-16)14-10-18(9-13(14)15)8-12-2-3-12/h5,7,12-15H,2-4,6,8-11H2,1H3/t13-,14+,15+/m0/s1 |
| InChIKey | JRQJFHZVWNASAR-RRFJBIMHSA-N |
| XLogP | 2.07 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |