C19H25F3N4O4 — CID 155830213
[(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155830213) has the molecular formula C19H25F3N4O4 and a molecular weight of 430.43 g/mol. Its IUPAC name is [(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830213 |
| Molecular Formula | C19H25F3N4O4 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [(4R,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1CCN(C(=O)c2ccncn2)[C@@H]2CN(CC3CC3)C[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O2.C2HF3O2/c1-23-16-5-7-21(17(22)14-4-6-18-11-19-14)15-10-20(9-13(15)16)8-12-2-3-12;3-2(4,5)1(6)7/h4,6,11-13,15-16H,2-3,5,7-10H2,1H3;(H,6,7)/t13-,15+,16+;/m0./s1 |
| InChIKey | MPUPUXQJOTUAPZ-QALYCTJVSA-N |
| XLogP | 1.68 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |