C21H26F4N2O4 — CID 155824478
[(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3-fluorophenyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155824478) has the molecular formula C21H26F4N2O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is [(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3-fluorophenyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3-fluorophenyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824478 |
| Molecular Formula | C21H26F4N2O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3-fluorophenyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@H]1CCN(C(=O)c2cccc(F)c2)[C@@H]2CN(CC3CC3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25FN2O2.C2HF3O2/c1-24-18-7-8-22(19(23)14-3-2-4-15(20)9-14)17-12-21(11-16(17)18)10-13-5-6-13;3-2(4,5)1(6)7/h2-4,9,13,16-18H,5-8,10-12H2,1H3;(H,6,7)/t16-,17+,18-;/m0./s1 |
| InChIKey | SQIBAGLWDPQYRW-RXQQAGQTSA-N |
| XLogP | 3.03 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |