C18H24F2N2O3 — CID 133144282
[(4R,4aR,7aR)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3,4-difluorophenyl)methanone (PubChem CID 133144282) has the molecular formula C18H24F2N2O3 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(4R,4aR,7aR)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [(4R,4aR,7aR)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 133144282 |
| Molecular Formula | C18H24F2N2O3 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [(4R,4aR,7aR)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(3,4-difluorophenyl)methanone |
| SMILES | COCCN1C[C@H]2[C@H](OC)CCN(C(=O)c3ccc(F)c(F)c3)[C@H]2C1 |
| InChI | InChI=1S/C18H24F2N2O3/c1-24-8-7-21-10-13-16(11-21)22(6-5-17(13)25-2)18(23)12-3-4-14(19)15(20)9-12/h3-4,9,13,16-17H,5-8,10-11H2,1-2H3/t13-,16+,17-/m1/s1 |
| InChIKey | WUDYTDKWFZREAW-XOKHGSTOSA-N |
| XLogP | 1.77 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |