C18H24F3N3O4 — CID 171694461
1-[(4S,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 171694461) has the molecular formula C18H24F3N3O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-[(4S,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4S,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694461 |
| Molecular Formula | C18H24F3N3O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[(4S,4aS,7aS)-4-methoxy-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@H]1CCN(C(C)=O)[C@@H]2CN(Cc3cccnc3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N3O2.C2HF3O2/c1-12(20)19-7-5-16(21-2)14-10-18(11-15(14)19)9-13-4-3-6-17-8-13;3-2(4,5)1(6)7/h3-4,6,8,14-16H,5,7,9-11H2,1-2H3;(H,6,7)/t14-,15+,16-;/m0./s1 |
| InChIKey | YUMPCVGEYCULIW-CLUYDPBTSA-N |
| XLogP | 1.78 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |