C22H27F6N3O6 — CID 155837778
[(4S,4aS,7aS)-4-methoxy-6-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-cyclopropylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155837778) has the molecular formula C22H27F6N3O6 and a molecular weight of 543.46 g/mol. Its IUPAC name is [(4S,4aS,7aS)-4-methoxy-6-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-cyclopropylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(4S,4aS,7aS)-4-methoxy-6-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-cyclopropylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155837778 |
| Molecular Formula | C22H27F6N3O6 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | [(4S,4aS,7aS)-4-methoxy-6-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-cyclopropylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CO[C@H]1CCN(C(=O)C2CC2)[C@@H]2CN(Cc3ccncc3)C[C@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N3O2.2C2HF3O2/c1-23-17-6-9-21(18(22)14-2-3-14)16-12-20(11-15(16)17)10-13-4-7-19-8-5-13;2*3-2(4,5)1(6)7/h4-5,7-8,14-17H,2-3,6,9-12H2,1H3;2*(H,6,7)/t15-,16+,17-;;/m0../s1 |
| InChIKey | DKEDYLCAUQLSSJ-ZKSXZVJESA-N |
| XLogP | 2.81 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |