C18H26N2O2S — CID 97421669
1-[(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-thiophen-3-ylethanone (PubChem CID 97421669) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-[(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 97421669 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-[(4S,4aS,7aS)-6-(cyclopropylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-thiophen-3-ylethanone |
| SMILES | CO[C@H]1CCN(C(=O)Cc2ccsc2)[C@@H]2CN(CC3CC3)C[C@H]12 |
| InChI | InChI=1S/C18H26N2O2S/c1-22-17-4-6-20(18(21)8-14-5-7-23-12-14)16-11-19(10-15(16)17)9-13-2-3-13/h5,7,12-13,15-17H,2-4,6,8-11H2,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | KNZGHELMSNPDLY-BBWFWOEESA-N |
| XLogP | 2.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |