C18H25NO3S — CID 124788320
1-[(3aS,5S,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone (PubChem CID 124788320) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(3aS,5S,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(3aS,5S,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 124788320 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[(3aS,5S,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CC[C@@H]2O[C@H](COCC3CC3)CC[C@@H]21 |
| InChI | InChI=1S/C18H25NO3S/c20-18(9-14-6-8-23-12-14)19-7-5-17-16(19)4-3-15(22-17)11-21-10-13-1-2-13/h6,8,12-13,15-17H,1-5,7,9-11H2/t15-,16-,17-/m0/s1 |
| InChIKey | BXFIATRRRCDTAL-ULQDDVLXSA-N |
| XLogP | 2.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |