C20H24N2O3 — CID 131642712
4-[(3aS,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carbonyl]benzonitrile (PubChem CID 131642712) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-[(3aS,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carbonyl]benzonitrile.
| Compound Name | 4-[(3aS,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 131642712 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-[(3aS,7aS)-5-(cyclopropylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carbonyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CC[C@@H]3OC(COCC4CC4)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H24N2O3/c21-11-14-3-5-16(6-4-14)20(23)22-10-9-19-18(22)8-7-17(25-19)13-24-12-15-1-2-15/h3-6,15,17-19H,1-2,7-10,12-13H2/t17?,18-,19-/m0/s1 |
| InChIKey | YJFQIEFAMFSYHJ-MNNMKWMVSA-N |
| XLogP | 2.75 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |