C20H24N2O3 — CID 134689967
1H-indol-5-yl-[(5R)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone (PubChem CID 134689967) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1H-indol-5-yl-[(5R)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone.
| Compound Name | 1H-indol-5-yl-[(5R)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 134689967 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1H-indol-5-yl-[(5R)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone |
| SMILES | C=CCOC[C@H]1CCC2C(CCN2C(=O)c2ccc3[nH]ccc3c2)O1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-11-24-13-16-4-6-18-19(25-16)8-10-22(18)20(23)15-3-5-17-14(12-15)7-9-21-17/h2-3,5,7,9,12,16,18-19,21H,1,4,6,8,10-11,13H2/t16-,18?,19?/m1/s1 |
| InChIKey | DVXCCUSJQNPSHY-IPJUCJBFSA-N |
| XLogP | 3.13 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|