C17H20N2O2 — CID 94613419
[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-6-yl)methanone (PubChem CID 94613419) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-6-yl)methanone.
| Compound Name | [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 94613419 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-6-yl)methanone |
| SMILES | O=C(c1ccc2cc[nH]c2c1)N1CCO[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C17H20N2O2/c20-17(13-6-5-12-7-8-18-14(12)11-13)19-9-10-21-16-4-2-1-3-15(16)19/h5-8,11,15-16,18H,1-4,9-10H2/t15-,16-/m0/s1 |
| InChIKey | JVEIOUIJVZVYDW-HOTGVXAUSA-N |
| XLogP | 2.95 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |