C18H25NO2 — CID 94487129
[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-tert-butylphenyl)methanone (PubChem CID 94487129) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 94487129 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-tert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCO[C@@H]3CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-18(2,3)14-9-7-13(8-10-14)17(20)19-11-12-21-16-6-4-5-15(16)19/h7-10,15-16H,4-6,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | JYHCGGUFGSWBMW-JKSUJKDBSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |