C15H18BrNO3 — CID 61344966
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-bromo-4-methoxyphenyl)methanone (PubChem CID 61344966) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-bromo-4-methoxyphenyl)methanone.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-bromo-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 61344966 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(3-bromo-4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCOC3CCCC32)cc1Br |
| InChI | InChI=1S/C15H18BrNO3/c1-19-13-6-5-10(9-11(13)16)15(18)17-7-8-20-14-4-2-3-12(14)17/h5-6,9,12,14H,2-4,7-8H2,1H3 |
| InChIKey | UVIRUENYQDWVDB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |