C23H34N2O5S — CID 55806516
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methanone (PubChem CID 55806516) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methanone |
|---|---|
| PubChem CID | 55806516 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methanone |
| SMILES | COc1ccc(C(=O)N2CCOC3CCCCC32)cc1S(=O)(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C23H34N2O5S/c1-16-12-17(2)15-24(14-16)31(27,28)22-13-18(8-9-21(22)29-3)23(26)25-10-11-30-20-7-5-4-6-19(20)25/h8-9,13,16-17,19-20H,4-7,10-12,14-15H2,1-3H3 |
| InChIKey | FCTQHNJHABTUIU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |