C17H24N2O5S — CID 95285624
(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-[(3R)-3-methylpyrrolidin-1-yl]methanone (PubChem CID 95285624) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is (4-methoxy-3-morpholin-4-ylsulfonylphenyl)-[(3R)-3-methylpyrrolidin-1-yl]methanone.
| Compound Name | (4-methoxy-3-morpholin-4-ylsulfonylphenyl)-[(3R)-3-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95285624 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (4-methoxy-3-morpholin-4-ylsulfonylphenyl)-[(3R)-3-methylpyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CC[C@@H](C)C2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H24N2O5S/c1-13-5-6-18(12-13)17(20)14-3-4-15(23-2)16(11-14)25(21,22)19-7-9-24-10-8-19/h3-4,11,13H,5-10,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | LLDQFERCAMSIJQ-CYBMUJFWSA-N |
| XLogP | 1.20 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |