C17H25N3O5S — CID 119631968
[2-(aminomethyl)pyrrolidin-1-yl]-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 119631968) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 119631968 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCC2CN)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H25N3O5S/c1-24-15-5-4-13(17(21)20-6-2-3-14(20)12-18)11-16(15)26(22,23)19-7-9-25-10-8-19/h4-5,11,14H,2-3,6-10,12,18H2,1H3 |
| InChIKey | QKFNIPGXXUHPLU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |