C15H21NO6S — CID 27000014
propyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 27000014) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is propyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | propyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 27000014 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | propyl 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCCOC(=O)c1ccc(OC)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H21NO6S/c1-3-8-22-15(17)12-4-5-13(20-2)14(11-12)23(18,19)16-6-9-21-10-7-16/h4-5,11H,3,6-10H2,1-2H3 |
| InChIKey | GHLUWMOAQMNULE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |