C24H29NO7S — CID 42985506
[2-(4-butylphenyl)-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 42985506) has the molecular formula C24H29NO7S and a molecular weight of 475.56 g/mol. Its IUPAC name is [2-(4-butylphenyl)-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(4-butylphenyl)-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42985506 |
| Molecular Formula | C24H29NO7S |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [2-(4-butylphenyl)-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCCCc1ccc(C(=O)COC(=O)c2ccc(OC)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C24H29NO7S/c1-3-4-5-18-6-8-19(9-7-18)21(26)17-32-24(27)20-10-11-22(30-2)23(16-20)33(28,29)25-12-14-31-15-13-25/h6-11,16H,3-5,12-15,17H2,1-2H3 |
| InChIKey | UVJZHHBNVWZJOF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |