C29H32N2O7S — CID 4565875
[2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 4565875) has the molecular formula C29H32N2O7S and a molecular weight of 552.65 g/mol. Its IUPAC name is [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4565875 |
| Molecular Formula | C29H32N2O7S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 4-methoxy-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N(CCc2ccccc2)Cc2ccccc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C29H32N2O7S/c1-36-26-13-12-25(20-27(26)39(34,35)31-16-18-37-19-17-31)29(33)38-22-28(32)30(21-24-10-6-3-7-11-24)15-14-23-8-4-2-5-9-23/h2-13,20H,14-19,21-22H2,1H3 |
| InChIKey | NHPLPUWZUAMKJB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |