C15H22N2O6S — CID 18892275
4-methoxy-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 18892275) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 18892275 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COCCNC(=O)c1ccc(OC)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H22N2O6S/c1-21-8-5-16-15(18)12-3-4-13(22-2)14(11-12)24(19,20)17-6-9-23-10-7-17/h3-4,11H,5-10H2,1-2H3,(H,16,18) |
| InChIKey | FAAQKGLEZLXQOM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|