C21H34N4O5S — CID 55656696
4-methoxy-N-[4-(4-methylpiperazin-1-yl)butyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55656696) has the molecular formula C21H34N4O5S and a molecular weight of 454.59 g/mol. Its IUPAC name is 4-methoxy-N-[4-(4-methylpiperazin-1-yl)butyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-methoxy-N-[4-(4-methylpiperazin-1-yl)butyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55656696 |
| Molecular Formula | C21H34N4O5S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-methoxy-N-[4-(4-methylpiperazin-1-yl)butyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)NCCCCN2CCN(C)CC2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H34N4O5S/c1-23-9-11-24(12-10-23)8-4-3-7-22-21(26)18-5-6-19(29-2)20(17-18)31(27,28)25-13-15-30-16-14-25/h5-6,17H,3-4,7-16H2,1-2H3,(H,22,26) |
| InChIKey | OYMZRCUFHJHTKF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|